C19H26N4O2 — CID 136545155
2-[4-[3-(dimethylamino)-2-methylpyrrolidin-1-yl]-4-oxobutyl]-3H-quinazolin-4-one (PubChem CID 136545155) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is 2-[4-[3-(dimethylamino)-2-methylpyrrolidin-1-yl]-4-oxobutyl]-3H-quinazolin-4-one.
| Compound Name | 2-[4-[3-(dimethylamino)-2-methylpyrrolidin-1-yl]-4-oxobutyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136545155 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 2-[4-[3-(dimethylamino)-2-methylpyrrolidin-1-yl]-4-oxobutyl]-3H-quinazolin-4-one |
| SMILES | CC1C(N(C)C)CCN1C(=O)CCCc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C19H26N4O2/c1-13-16(22(2)3)11-12-23(13)18(24)10-6-9-17-20-15-8-5-4-7-14(15)19(25)21-17/h4-5,7-8,13,16H,6,9-12H2,1-3H3,(H,20,21,25) |
| InChIKey | VPPUSGLXXHVQAJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |