C24H30N4O3 — CID 137218698
2-[4-[4-[(2E)-2-(dimethylaminomethylidene)but-3-enoyl]piperidin-1-yl]-4-oxobutyl]-3H-quinazolin-4-one (PubChem CID 137218698) has the molecular formula C24H30N4O3 and a molecular weight of 422.53 g/mol. Its IUPAC name is 2-[4-[4-[(2E)-2-(dimethylaminomethylidene)but-3-enoyl]piperidin-1-yl]-4-oxobutyl]-3H-quinazolin-4-one.
| Compound Name | 2-[4-[4-[(2E)-2-(dimethylaminomethylidene)but-3-enoyl]piperidin-1-yl]-4-oxobutyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137218698 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | 2-[4-[4-[(2E)-2-(dimethylaminomethylidene)but-3-enoyl]piperidin-1-yl]-4-oxobutyl]-3H-quinazolin-4-one |
| SMILES | C=C/C(=C\N(C)C)C(=O)C1CCN(C(=O)CCCc2nc3ccccc3c(=O)[nH]2)CC1 |
| InChI | InChI=1S/C24H30N4O3/c1-4-17(16-27(2)3)23(30)18-12-14-28(15-13-18)22(29)11-7-10-21-25-20-9-6-5-8-19(20)24(31)26-21/h4-6,8-9,16,18H,1,7,10-15H2,2-3H3,(H,25,26,31)/b17-16+ |
| InChIKey | LVTZVNKSAPKRSJ-WUKNDPDISA-N |
| XLogP | 2.68 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|