C23H23N5O3 — CID 136628924
2-[4-[4-(2,1-benzoxazol-3-yl)piperazin-1-yl]-4-oxobutyl]-3H-quinazolin-4-one (PubChem CID 136628924) has the molecular formula C23H23N5O3 and a molecular weight of 417.47 g/mol. Its IUPAC name is 2-[4-[4-(2,1-benzoxazol-3-yl)piperazin-1-yl]-4-oxobutyl]-3H-quinazolin-4-one.
| Compound Name | 2-[4-[4-(2,1-benzoxazol-3-yl)piperazin-1-yl]-4-oxobutyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136628924 |
| Molecular Formula | C23H23N5O3 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 2-[4-[4-(2,1-benzoxazol-3-yl)piperazin-1-yl]-4-oxobutyl]-3H-quinazolin-4-one |
| SMILES | O=C(CCCc1nc2ccccc2c(=O)[nH]1)N1CCN(c2onc3ccccc23)CC1 |
| InChI | InChI=1S/C23H23N5O3/c29-21(11-5-10-20-24-18-8-3-1-6-16(18)22(30)25-20)27-12-14-28(15-13-27)23-17-7-2-4-9-19(17)26-31-23/h1-4,6-9H,5,10-15H2,(H,24,25,30) |
| InChIKey | MJURPWUDUXZUOM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 95.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |