C27H36N4O3 — CID 137218689
2-[(2R)-2-methyl-4-[4-[(2E)-2-[[methyl(propan-2-yl)amino]methylidene]but-3-enoyl]piperidin-1-yl]-4-oxobutyl]-3H-quinazolin-4-one (PubChem CID 137218689) has the molecular formula C27H36N4O3 and a molecular weight of 464.61 g/mol. Its IUPAC name is 2-[(2R)-2-methyl-4-[4-[(2E)-2-[[methyl(propan-2-yl)amino]methylidene]but-3-enoyl]piperidin-1-yl]-4-oxobutyl]-3H-quinazolin-4-one.
| Compound Name | 2-[(2R)-2-methyl-4-[4-[(2E)-2-[[methyl(propan-2-yl)amino]methylidene]but-3-enoyl]piperidin-1-yl]-4-oxobutyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137218689 |
| Molecular Formula | C27H36N4O3 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | 2-[(2R)-2-methyl-4-[4-[(2E)-2-[[methyl(propan-2-yl)amino]methylidene]but-3-enoyl]piperidin-1-yl]-4-oxobutyl]-3H-quinazolin-4-one |
| SMILES | C=C/C(=C\N(C)C(C)C)C(=O)C1CCN(C(=O)C[C@H](C)Cc2nc3ccccc3c(=O)[nH]2)CC1 |
| InChI | InChI=1S/C27H36N4O3/c1-6-20(17-30(5)18(2)3)26(33)21-11-13-31(14-12-21)25(32)16-19(4)15-24-28-23-10-8-7-9-22(23)27(34)29-24/h6-10,17-19,21H,1,11-16H2,2-5H3,(H,28,29,34)/b20-17+/t19-/m1/s1 |
| InChIKey | VXVIFLNZUFYYDX-WENBPLFZSA-N |
| XLogP | 3.71 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|