C19H21ClN4O2 — CID 136545594
6-[4-[(4-chlorophenyl)methyl]piperazine-1-carbonyl]-4-methylpyridine-3-carboxamide (PubChem CID 136545594) has the molecular formula C19H21ClN4O2 and a molecular weight of 372.86 g/mol. Its IUPAC name is 6-[4-[(4-chlorophenyl)methyl]piperazine-1-carbonyl]-4-methylpyridine-3-carboxamide.
| Compound Name | 6-[4-[(4-chlorophenyl)methyl]piperazine-1-carbonyl]-4-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 136545594 |
| Molecular Formula | C19H21ClN4O2 |
| Molecular Weight | 372.86 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 6-[4-[(4-chlorophenyl)methyl]piperazine-1-carbonyl]-4-methylpyridine-3-carboxamide |
| SMILES | Cc1cc(C(=O)N2CCN(Cc3ccc(Cl)cc3)CC2)ncc1C(N)=O |
| InChI | InChI=1S/C19H21ClN4O2/c1-13-10-17(22-11-16(13)18(21)25)19(26)24-8-6-23(7-9-24)12-14-2-4-15(20)5-3-14/h2-5,10-11H,6-9,12H2,1H3,(H2,21,25) |
| InChIKey | HJWUBCBYLVHDOZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.86 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |