C15H17N3O4 — CID 136546905
4-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-2-methoxybenzoic acid (PubChem CID 136546905) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is 4-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-2-methoxybenzoic acid.
| Compound Name | 4-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 136546905 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 4-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-2-methoxybenzoic acid |
| SMILES | CCn1nc(C)cc1C(=O)Nc1ccc(C(=O)O)c(OC)c1 |
| InChI | InChI=1S/C15H17N3O4/c1-4-18-12(7-9(2)17-18)14(19)16-10-5-6-11(15(20)21)13(8-10)22-3/h5-8H,4H2,1-3H3,(H,16,19)(H,20,21) |
| InChIKey | JXCMBHUIDIINRL-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |