C13H14N4O4 — CID 107208712
4-[(5-ethyl-1H-1,2,4-triazole-3-carbonyl)amino]-2-methoxybenzoic acid (PubChem CID 107208712) has the molecular formula C13H14N4O4 and a molecular weight of 290.28 g/mol. Its IUPAC name is 4-[(5-ethyl-1H-1,2,4-triazole-3-carbonyl)amino]-2-methoxybenzoic acid.
| Compound Name | 4-[(5-ethyl-1H-1,2,4-triazole-3-carbonyl)amino]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 107208712 |
| Molecular Formula | C13H14N4O4 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 4-[(5-ethyl-1H-1,2,4-triazole-3-carbonyl)amino]-2-methoxybenzoic acid |
| SMILES | CCc1nc(C(=O)Nc2ccc(C(=O)O)c(OC)c2)n[nH]1 |
| InChI | InChI=1S/C13H14N4O4/c1-3-10-15-11(17-16-10)12(18)14-7-4-5-8(13(19)20)9(6-7)21-2/h4-6H,3H2,1-2H3,(H,14,18)(H,19,20)(H,15,16,17) |
| InChIKey | ZRUAMFFWNFURIE-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |