C12H13BrN4O2 — CID 82858724
N-(4-bromo-3-methoxyphenyl)-5-ethyl-1H-1,2,4-triazole-3-carboxamide (PubChem CID 82858724) has the molecular formula C12H13BrN4O2 and a molecular weight of 325.17 g/mol. Its IUPAC name is N-(4-bromo-3-methoxyphenyl)-5-ethyl-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | N-(4-bromo-3-methoxyphenyl)-5-ethyl-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 82858724 |
| Molecular Formula | C12H13BrN4O2 |
| Molecular Weight | 325.17 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | N-(4-bromo-3-methoxyphenyl)-5-ethyl-1H-1,2,4-triazole-3-carboxamide |
| SMILES | CCc1nc(C(=O)Nc2ccc(Br)c(OC)c2)n[nH]1 |
| InChI | InChI=1S/C12H13BrN4O2/c1-3-10-15-11(17-16-10)12(18)14-7-4-5-8(13)9(6-7)19-2/h4-6H,3H2,1-2H3,(H,14,18)(H,15,16,17) |
| InChIKey | DQTXEVCZTANICT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.17 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |