C18H25NO4 — CID 136547898
1-(4-hydroxy-2-phenylpyrrolidin-1-yl)-3-(oxolan-2-ylmethoxy)propan-1-one (PubChem CID 136547898) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is 1-(4-hydroxy-2-phenylpyrrolidin-1-yl)-3-(oxolan-2-ylmethoxy)propan-1-one.
| Compound Name | 1-(4-hydroxy-2-phenylpyrrolidin-1-yl)-3-(oxolan-2-ylmethoxy)propan-1-one |
|---|---|
| PubChem CID | 136547898 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 1-(4-hydroxy-2-phenylpyrrolidin-1-yl)-3-(oxolan-2-ylmethoxy)propan-1-one |
| SMILES | O=C(CCOCC1CCCO1)N1CC(O)CC1c1ccccc1 |
| InChI | InChI=1S/C18H25NO4/c20-15-11-17(14-5-2-1-3-6-14)19(12-15)18(21)8-10-22-13-16-7-4-9-23-16/h1-3,5-6,15-17,20H,4,7-13H2 |
| InChIKey | DSTFSABDNJTQRJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|