C19H26FNO3 — CID 124741648
1-[(2R,4R)-4-(4-fluorophenyl)-2-methylpyrrolidin-1-yl]-3-[[(2R)-oxolan-2-yl]methoxy]propan-1-one (PubChem CID 124741648) has the molecular formula C19H26FNO3 and a molecular weight of 335.42 g/mol. Its IUPAC name is 1-[(2R,4R)-4-(4-fluorophenyl)-2-methylpyrrolidin-1-yl]-3-[[(2R)-oxolan-2-yl]methoxy]propan-1-one.
| Compound Name | 1-[(2R,4R)-4-(4-fluorophenyl)-2-methylpyrrolidin-1-yl]-3-[[(2R)-oxolan-2-yl]methoxy]propan-1-one |
|---|---|
| PubChem CID | 124741648 |
| Molecular Formula | C19H26FNO3 |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 1-[(2R,4R)-4-(4-fluorophenyl)-2-methylpyrrolidin-1-yl]-3-[[(2R)-oxolan-2-yl]methoxy]propan-1-one |
| SMILES | C[C@@H]1C[C@H](c2ccc(F)cc2)CN1C(=O)CCOC[C@H]1CCCO1 |
| InChI | InChI=1S/C19H26FNO3/c1-14-11-16(15-4-6-17(20)7-5-15)12-21(14)19(22)8-10-23-13-18-3-2-9-24-18/h4-7,14,16,18H,2-3,8-13H2,1H3/t14-,16+,18-/m1/s1 |
| InChIKey | WSNDWUSDYKJPCT-UWWQBHOKSA-N |
| XLogP | 3.12 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|