C12H20N2O4 — CID 136548040
[1-(3-ethoxyprop-2-enoyl)pyrrolidin-3-yl] N,N-dimethylcarbamate (PubChem CID 136548040) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is [1-(3-ethoxyprop-2-enoyl)pyrrolidin-3-yl] N,N-dimethylcarbamate.
| Compound Name | [1-(3-ethoxyprop-2-enoyl)pyrrolidin-3-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 136548040 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | [1-(3-ethoxyprop-2-enoyl)pyrrolidin-3-yl] N,N-dimethylcarbamate |
| SMILES | CCOC=CC(=O)N1CCC(OC(=O)N(C)C)C1 |
| InChI | InChI=1S/C12H20N2O4/c1-4-17-8-6-11(15)14-7-5-10(9-14)18-12(16)13(2)3/h6,8,10H,4-5,7,9H2,1-3H3 |
| InChIKey | YUIKDBNAVLHJOK-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|