C16H18N6OS — CID 136548736
3,7-dimethyl-N-(2-methyl-1,3-benzothiazol-5-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxamide (PubChem CID 136548736) has the molecular formula C16H18N6OS and a molecular weight of 342.43 g/mol. Its IUPAC name is 3,7-dimethyl-N-(2-methyl-1,3-benzothiazol-5-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxamide.
| Compound Name | 3,7-dimethyl-N-(2-methyl-1,3-benzothiazol-5-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxamide |
|---|---|
| PubChem CID | 136548736 |
| Molecular Formula | C16H18N6OS |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 3,7-dimethyl-N-(2-methyl-1,3-benzothiazol-5-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxamide |
| SMILES | Cc1nc2cc(NC(=O)C3Cn4c(C)nnc4CN3C)ccc2s1 |
| InChI | InChI=1S/C16H18N6OS/c1-9-19-20-15-8-21(3)13(7-22(9)15)16(23)18-11-4-5-14-12(6-11)17-10(2)24-14/h4-6,13H,7-8H2,1-3H3,(H,18,23) |
| InChIKey | SQDDZYQHQFVWTR-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |