C12H11FN2O3S — CID 136549203
3-[(5-fluoro-4-methyl-1,3-benzothiazol-2-yl)amino]-2-methyl-3-oxopropanoic acid (PubChem CID 136549203) has the molecular formula C12H11FN2O3S and a molecular weight of 282.30 g/mol. Its IUPAC name is 3-[(5-fluoro-4-methyl-1,3-benzothiazol-2-yl)amino]-2-methyl-3-oxopropanoic acid.
| Compound Name | 3-[(5-fluoro-4-methyl-1,3-benzothiazol-2-yl)amino]-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 136549203 |
| Molecular Formula | C12H11FN2O3S |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 3-[(5-fluoro-4-methyl-1,3-benzothiazol-2-yl)amino]-2-methyl-3-oxopropanoic acid |
| SMILES | Cc1c(F)ccc2sc(NC(=O)C(C)C(=O)O)nc12 |
| InChI | InChI=1S/C12H11FN2O3S/c1-5-7(13)3-4-8-9(5)14-12(19-8)15-10(16)6(2)11(17)18/h3-4,6H,1-2H3,(H,17,18)(H,14,15,16) |
| InChIKey | KSKJHEPKKYWEEM-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|