C20H21ClFNO3 — CID 136550465
2-chloro-3-[[4-[(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]methyl]benzoic acid (PubChem CID 136550465) has the molecular formula C20H21ClFNO3 and a molecular weight of 377.84 g/mol. Its IUPAC name is 2-chloro-3-[[4-[(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]methyl]benzoic acid.
| Compound Name | 2-chloro-3-[[4-[(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 136550465 |
| Molecular Formula | C20H21ClFNO3 |
| Molecular Weight | 377.84 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 2-chloro-3-[[4-[(4-fluorophenyl)-hydroxymethyl]piperidin-1-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CN2CCC(C(O)c3ccc(F)cc3)CC2)c1Cl |
| InChI | InChI=1S/C20H21ClFNO3/c21-18-15(2-1-3-17(18)20(25)26)12-23-10-8-14(9-11-23)19(24)13-4-6-16(22)7-5-13/h1-7,14,19,24H,8-12H2,(H,25,26) |
| InChIKey | QFXJHGOUIXRRJX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.84 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |