C15H16ClN3O5S — CID 136551728
2-chloro-4-[[1-(oxan-4-yl)pyrazol-3-yl]sulfamoyl]benzoic acid (PubChem CID 136551728) has the molecular formula C15H16ClN3O5S and a molecular weight of 385.83 g/mol. Its IUPAC name is 2-chloro-4-[[1-(oxan-4-yl)pyrazol-3-yl]sulfamoyl]benzoic acid.
| Compound Name | 2-chloro-4-[[1-(oxan-4-yl)pyrazol-3-yl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 136551728 |
| Molecular Formula | C15H16ClN3O5S |
| Molecular Weight | 385.83 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 2-chloro-4-[[1-(oxan-4-yl)pyrazol-3-yl]sulfamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)Nc2ccn(C3CCOCC3)n2)cc1Cl |
| InChI | InChI=1S/C15H16ClN3O5S/c16-13-9-11(1-2-12(13)15(20)21)25(22,23)18-14-3-6-19(17-14)10-4-7-24-8-5-10/h1-3,6,9-10H,4-5,7-8H2,(H,17,18)(H,20,21) |
| InChIKey | WMSSGVNACBIPSJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.83 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |