C14H16ClNO5S — CID 146109222
2-chloro-4-[[(2S,3R)-2-cyclopropyloxolan-3-yl]sulfamoyl]benzoic acid (PubChem CID 146109222) has the molecular formula C14H16ClNO5S and a molecular weight of 345.80 g/mol. Its IUPAC name is 2-chloro-4-[[(2S,3R)-2-cyclopropyloxolan-3-yl]sulfamoyl]benzoic acid.
| Compound Name | 2-chloro-4-[[(2S,3R)-2-cyclopropyloxolan-3-yl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 146109222 |
| Molecular Formula | C14H16ClNO5S |
| Molecular Weight | 345.80 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 2-chloro-4-[[(2S,3R)-2-cyclopropyloxolan-3-yl]sulfamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)N[C@@H]2CCO[C@H]2C2CC2)cc1Cl |
| InChI | InChI=1S/C14H16ClNO5S/c15-11-7-9(3-4-10(11)14(17)18)22(19,20)16-12-5-6-21-13(12)8-1-2-8/h3-4,7-8,12-13,16H,1-2,5-6H2,(H,17,18)/t12-,13+/m1/s1 |
| InChIKey | BVHNPNRUFKXNFT-OLZOCXBDSA-N |
| XLogP | 1.88 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.80 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |