C16H18N2O5 — CID 136556676
4-methyl-2-[(2-methyl-3-oxo-4H-1,4-benzoxazine-8-carbonyl)amino]pent-4-enoic acid (PubChem CID 136556676) has the molecular formula C16H18N2O5 and a molecular weight of 318.33 g/mol. Its IUPAC name is 4-methyl-2-[(2-methyl-3-oxo-4H-1,4-benzoxazine-8-carbonyl)amino]pent-4-enoic acid.
| Compound Name | 4-methyl-2-[(2-methyl-3-oxo-4H-1,4-benzoxazine-8-carbonyl)amino]pent-4-enoic acid |
|---|---|
| PubChem CID | 136556676 |
| Molecular Formula | C16H18N2O5 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 4-methyl-2-[(2-methyl-3-oxo-4H-1,4-benzoxazine-8-carbonyl)amino]pent-4-enoic acid |
| SMILES | C=C(C)CC(NC(=O)c1cccc2c1OC(C)C(=O)N2)C(=O)O |
| InChI | InChI=1S/C16H18N2O5/c1-8(2)7-12(16(21)22)18-15(20)10-5-4-6-11-13(10)23-9(3)14(19)17-11/h4-6,9,12H,1,7H2,2-3H3,(H,17,19)(H,18,20)(H,21,22) |
| InChIKey | RUWXJHQAOPUGBV-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|