C18H22N4O2 — CID 136557057
methyl 3-(3,4-dihydro-2H-quinolin-1-ylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-7-carboxylate (PubChem CID 136557057) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is methyl 3-(3,4-dihydro-2H-quinolin-1-ylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-7-carboxylate.
| Compound Name | methyl 3-(3,4-dihydro-2H-quinolin-1-ylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-7-carboxylate |
|---|---|
| PubChem CID | 136557057 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | methyl 3-(3,4-dihydro-2H-quinolin-1-ylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-7-carboxylate |
| SMILES | COC(=O)C1CCn2c(nnc2CN2CCCc3ccccc32)C1 |
| InChI | InChI=1S/C18H22N4O2/c1-24-18(23)14-8-10-22-16(11-14)19-20-17(22)12-21-9-4-6-13-5-2-3-7-15(13)21/h2-3,5,7,14H,4,6,8-12H2,1H3 |
| InChIKey | BVJFONCUPWWPPN-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |