C13H13ClN6O3 — CID 136558973
3-[(4-chloro-2-nitroanilino)methyl]-7-methyl-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-8-one (PubChem CID 136558973) has the molecular formula C13H13ClN6O3 and a molecular weight of 336.74 g/mol. Its IUPAC name is 3-[(4-chloro-2-nitroanilino)methyl]-7-methyl-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-8-one.
| Compound Name | 3-[(4-chloro-2-nitroanilino)methyl]-7-methyl-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-8-one |
|---|---|
| PubChem CID | 136558973 |
| Molecular Formula | C13H13ClN6O3 |
| Molecular Weight | 336.74 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 3-[(4-chloro-2-nitroanilino)methyl]-7-methyl-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-8-one |
| SMILES | CN1CCn2c(CNc3ccc(Cl)cc3[N+](=O)[O-])nnc2C1=O |
| InChI | InChI=1S/C13H13ClN6O3/c1-18-4-5-19-11(16-17-12(19)13(18)21)7-15-9-3-2-8(14)6-10(9)20(22)23/h2-3,6,15H,4-5,7H2,1H3 |
| InChIKey | YYCKPFZGIZCQCF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 106.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.74 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|