C17H21N3O3S — CID 136559239
1-[1-(3,4-dimethylphenyl)ethyl]-3-(4-methylsulfonyl-2-pyridinyl)urea (PubChem CID 136559239) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is 1-[1-(3,4-dimethylphenyl)ethyl]-3-(4-methylsulfonyl-2-pyridinyl)urea.
| Compound Name | 1-[1-(3,4-dimethylphenyl)ethyl]-3-(4-methylsulfonyl-2-pyridinyl)urea |
|---|---|
| PubChem CID | 136559239 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 1-[1-(3,4-dimethylphenyl)ethyl]-3-(4-methylsulfonyl-2-pyridinyl)urea |
| SMILES | Cc1ccc(C(C)NC(=O)Nc2cc(S(C)(=O)=O)ccn2)cc1C |
| InChI | InChI=1S/C17H21N3O3S/c1-11-5-6-14(9-12(11)2)13(3)19-17(21)20-16-10-15(7-8-18-16)24(4,22)23/h5-10,13H,1-4H3,(H2,18,19,20,21) |
| InChIKey | DOXBIGOONUZUBA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |