C14H19FN2O2 — CID 136559360
4-(3-ethynyl-3-fluoroazetidine-1-carbonyl)-1-(2-methylpropyl)pyrrolidin-2-one (PubChem CID 136559360) has the molecular formula C14H19FN2O2 and a molecular weight of 266.32 g/mol. Its IUPAC name is 4-(3-ethynyl-3-fluoroazetidine-1-carbonyl)-1-(2-methylpropyl)pyrrolidin-2-one.
| Compound Name | 4-(3-ethynyl-3-fluoroazetidine-1-carbonyl)-1-(2-methylpropyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 136559360 |
| Molecular Formula | C14H19FN2O2 |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 4-(3-ethynyl-3-fluoroazetidine-1-carbonyl)-1-(2-methylpropyl)pyrrolidin-2-one |
| SMILES | C#CC1(F)CN(C(=O)C2CC(=O)N(CC(C)C)C2)C1 |
| InChI | InChI=1S/C14H19FN2O2/c1-4-14(15)8-17(9-14)13(19)11-5-12(18)16(7-11)6-10(2)3/h1,10-11H,5-9H2,2-3H3 |
| InChIKey | JURBTDAYXQEYDL-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|