About [2-(4-bromophenyl)-2-oxoethyl] (Z)-3-amino-2-cyano-N-phenylbut-2-enimidothioate;hydrochloride
[2-(4-bromophenyl)-2-oxoethyl] (Z)-3-amino-2-cyano-N-phenylbut-2-enimidothioate;hydrochloride (PubChem CID 136559418) has the molecular formula C19H17BrClN3OS
and a molecular weight of 450.79 g/mol. Its IUPAC name is [2-(4-bromophenyl)-2-oxoethyl] (Z)-3-amino-2-cyano-N-phenylbut-2-enimidothioate;hydrochloride.
Molecular Properties
| Compound Name | [2-(4-bromophenyl)-2-oxoethyl] (Z)-3-amino-2-cyano-N-phenylbut-2-enimidothioate;hydrochloride |
| PubChem CID | 136559418 |
| Molecular Formula | C19H17BrClN3OS |
| Molecular Weight | 450.79 g/mol |
| Exact Mass | 449.00 |
| IUPAC Name | [2-(4-bromophenyl)-2-oxoethyl] (Z)-3-amino-2-cyano-N-phenylbut-2-enimidothioate;hydrochloride |
| SMILES | C/C(N)=C(C#N)/C(=N\c1ccccc1)SCC(=O)c1ccc(Br)cc1.Cl |
| InChI | InChI=1S/C19H16BrN3OS.ClH/c1-13(22)17(11-21)19(23-16-5-3-2-4-6-16)25-12-18(24)14-7-9-15(20)10-8-14;/h2-10H,12,22H2,1H3;1H/b17-13-,23-19+; |
| InChIKey | KLBDLZRDVJNYIU-LEZXKERISA-N |
| XLogP | 5.27 |
| TPSA | 79.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.79 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [2-(4-bromophenyl)-2-oxoethyl] (Z)-3-amino-2-cyano-N-phenylbut-2-enimidothioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-bromophenyl)-2-oxoethyl] (Z)-3-amino-2-cyano-N-phenylbut-2-enimidothioate;hydrochloride?
The IUPAC name of [2-(4-bromophenyl)-2-oxoethyl] (Z)-3-amino-2-cyano-N-phenylbut-2-enimidothioate;hydrochloride (CID 136559418) is [2-(4-bromophenyl)-2-oxoethyl] (Z)-3-amino-2-cyano-N-phenylbut-2-enimidothioate;hydrochloride.
What is the SMILES notation for [2-(4-bromophenyl)-2-oxoethyl] (Z)-3-amino-2-cyano-N-phenylbut-2-enimidothioate;hydrochloride?
The canonical SMILES for [2-(4-bromophenyl)-2-oxoethyl] (Z)-3-amino-2-cyano-N-phenylbut-2-enimidothioate;hydrochloride is C/C(N)=C(C#N)/C(=N\c1ccccc1)SCC(=O)c1ccc(Br)cc1.Cl.
What is the InChIKey of [2-(4-bromophenyl)-2-oxoethyl] (Z)-3-amino-2-cyano-N-phenylbut-2-enimidothioate;hydrochloride?
The InChIKey is KLBDLZRDVJNYIU-LEZXKERISA-N. The full InChI is InChI=1S/C19H16BrN3OS.ClH/c1-13(22)17(11-21)19(23-16-5-3-2-4-6-16)25-12-18(24)14-7-9-15(20)10-8-14;/h2-10H,12,22H2,1H3;1H/b17-13-,23-19+;.
What are the key properties of [2-(4-bromophenyl)-2-oxoethyl] (Z)-3-amino-2-cyano-N-phenylbut-2-enimidothioate;hydrochloride?
[2-(4-bromophenyl)-2-oxoethyl] (Z)-3-amino-2-cyano-N-phenylbut-2-enimidothioate;hydrochloride has a molecular weight of 450.79 g/mol, XLogP of 5.27, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-bromophenyl)-2-oxoethyl] (Z)-3-amino-2-cyano-N-phenylbut-2-enimidothioate;hydrochloride is sourced from PubChem (CID 136559418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).