C18H13BrN2O2S2 — CID 11510800
(E)-N-(4-bromophenyl)-2-cyano-3-phenacylsulfanyl-3-sulfanylprop-2-enamide (PubChem CID 11510800) has the molecular formula C18H13BrN2O2S2 and a molecular weight of 433.35 g/mol. Its IUPAC name is (E)-N-(4-bromophenyl)-2-cyano-3-phenacylsulfanyl-3-sulfanylprop-2-enamide.
| Compound Name | (E)-N-(4-bromophenyl)-2-cyano-3-phenacylsulfanyl-3-sulfanylprop-2-enamide |
|---|---|
| PubChem CID | 11510800 |
| Molecular Formula | C18H13BrN2O2S2 |
| Molecular Weight | 433.35 g/mol |
| Exact Mass | 431.96 |
| IUPAC Name | (E)-N-(4-bromophenyl)-2-cyano-3-phenacylsulfanyl-3-sulfanylprop-2-enamide |
| SMILES | N#C/C(C(=O)Nc1ccc(Br)cc1)=C(/S)SCC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H13BrN2O2S2/c19-13-6-8-14(9-7-13)21-17(23)15(10-20)18(24)25-11-16(22)12-4-2-1-3-5-12/h1-9,24H,11H2,(H,21,23)/b18-15+ |
| InChIKey | BFQONDJSXJIZAD-OBGWFSINSA-N |
| XLogP | 4.67 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.35 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|