C14H18ClF2NO — CID 136560538
N-[1-(3-chlorophenyl)-2,2-difluoroethyl]-2-methyloxan-4-amine (PubChem CID 136560538) has the molecular formula C14H18ClF2NO and a molecular weight of 289.75 g/mol. Its IUPAC name is N-[1-(3-chlorophenyl)-2,2-difluoroethyl]-2-methyloxan-4-amine.
| Compound Name | N-[1-(3-chlorophenyl)-2,2-difluoroethyl]-2-methyloxan-4-amine |
|---|---|
| PubChem CID | 136560538 |
| Molecular Formula | C14H18ClF2NO |
| Molecular Weight | 289.75 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | N-[1-(3-chlorophenyl)-2,2-difluoroethyl]-2-methyloxan-4-amine |
| SMILES | CC1CC(NC(c2cccc(Cl)c2)C(F)F)CCO1 |
| InChI | InChI=1S/C14H18ClF2NO/c1-9-7-12(5-6-19-9)18-13(14(16)17)10-3-2-4-11(15)8-10/h2-4,8-9,12-14,18H,5-7H2,1H3 |
| InChIKey | YTTQWRQXSWSOMM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.75 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |