C18H24N2O4 — CID 136560958
1-[4-(2-aminoethyl)-4-hydroxypiperidin-1-yl]-2-(6-methoxy-1-benzofuran-3-yl)ethanone (PubChem CID 136560958) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is 1-[4-(2-aminoethyl)-4-hydroxypiperidin-1-yl]-2-(6-methoxy-1-benzofuran-3-yl)ethanone.
| Compound Name | 1-[4-(2-aminoethyl)-4-hydroxypiperidin-1-yl]-2-(6-methoxy-1-benzofuran-3-yl)ethanone |
|---|---|
| PubChem CID | 136560958 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 1-[4-(2-aminoethyl)-4-hydroxypiperidin-1-yl]-2-(6-methoxy-1-benzofuran-3-yl)ethanone |
| SMILES | COc1ccc2c(CC(=O)N3CCC(O)(CCN)CC3)coc2c1 |
| InChI | InChI=1S/C18H24N2O4/c1-23-14-2-3-15-13(12-24-16(15)11-14)10-17(21)20-8-5-18(22,4-7-19)6-9-20/h2-3,11-12,22H,4-10,19H2,1H3 |
| InChIKey | OXTUCLIADVATCQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 88.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |