C23H27N2O4+ — CID 9467205
2-(6-methoxy-1-benzofuran-3-yl)-1-[4-(2-phenoxyethyl)piperazin-4-ium-1-yl]ethanone (PubChem CID 9467205) has the molecular formula C23H27N2O4+ and a molecular weight of 395.48 g/mol. Its IUPAC name is 2-(6-methoxy-1-benzofuran-3-yl)-1-[4-(2-phenoxyethyl)piperazin-4-ium-1-yl]ethanone.
| Compound Name | 2-(6-methoxy-1-benzofuran-3-yl)-1-[4-(2-phenoxyethyl)piperazin-4-ium-1-yl]ethanone |
|---|---|
| PubChem CID | 9467205 |
| Molecular Formula | C23H27N2O4+ |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 2-(6-methoxy-1-benzofuran-3-yl)-1-[4-(2-phenoxyethyl)piperazin-4-ium-1-yl]ethanone |
| SMILES | COc1ccc2c(CC(=O)N3CC[NH+](CCOc4ccccc4)CC3)coc2c1 |
| InChI | InChI=1S/C23H26N2O4/c1-27-20-7-8-21-18(17-29-22(21)16-20)15-23(26)25-11-9-24(10-12-25)13-14-28-19-5-3-2-4-6-19/h2-8,16-17H,9-15H2,1H3/p+1 |
| InChIKey | CANKHGWYTFLZAH-UHFFFAOYSA-O |
| XLogP | 1.79 |
| TPSA | 56.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |