C24H27NO4 — CID 96530007
2-(6-methoxy-1-benzofuran-3-yl)-1-[(3R)-3-(3-phenylpropoxy)pyrrolidin-1-yl]ethanone (PubChem CID 96530007) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is 2-(6-methoxy-1-benzofuran-3-yl)-1-[(3R)-3-(3-phenylpropoxy)pyrrolidin-1-yl]ethanone.
| Compound Name | 2-(6-methoxy-1-benzofuran-3-yl)-1-[(3R)-3-(3-phenylpropoxy)pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 96530007 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 2-(6-methoxy-1-benzofuran-3-yl)-1-[(3R)-3-(3-phenylpropoxy)pyrrolidin-1-yl]ethanone |
| SMILES | COc1ccc2c(CC(=O)N3CC[C@@H](OCCCc4ccccc4)C3)coc2c1 |
| InChI | InChI=1S/C24H27NO4/c1-27-20-9-10-22-19(17-29-23(22)15-20)14-24(26)25-12-11-21(16-25)28-13-5-8-18-6-3-2-4-7-18/h2-4,6-7,9-10,15,17,21H,5,8,11-14,16H2,1H3/t21-/m1/s1 |
| InChIKey | DLWGIEDGAWTZLB-OAQYLSRUSA-N |
| XLogP | 4.23 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|