C16H19F2NO4 — CID 136561248
methyl 4-[3-[3-(difluoromethoxy)phenyl]propanoylamino]-2-methylbut-2-enoate (PubChem CID 136561248) has the molecular formula C16H19F2NO4 and a molecular weight of 327.33 g/mol. Its IUPAC name is methyl 4-[3-[3-(difluoromethoxy)phenyl]propanoylamino]-2-methylbut-2-enoate.
| Compound Name | methyl 4-[3-[3-(difluoromethoxy)phenyl]propanoylamino]-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 136561248 |
| Molecular Formula | C16H19F2NO4 |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | methyl 4-[3-[3-(difluoromethoxy)phenyl]propanoylamino]-2-methylbut-2-enoate |
| SMILES | COC(=O)C(C)=CCNC(=O)CCc1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C16H19F2NO4/c1-11(15(21)22-2)8-9-19-14(20)7-6-12-4-3-5-13(10-12)23-16(17)18/h3-5,8,10,16H,6-7,9H2,1-2H3,(H,19,20) |
| InChIKey | JMKVOHDXBJFZBB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|