C15H21F2N3O2 — CID 136563929
N-[4-(difluoromethyl)phenyl]-4-(2-hydroxyethyl)-3-methylpiperazine-1-carboxamide (PubChem CID 136563929) has the molecular formula C15H21F2N3O2 and a molecular weight of 313.35 g/mol. Its IUPAC name is N-[4-(difluoromethyl)phenyl]-4-(2-hydroxyethyl)-3-methylpiperazine-1-carboxamide.
| Compound Name | N-[4-(difluoromethyl)phenyl]-4-(2-hydroxyethyl)-3-methylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 136563929 |
| Molecular Formula | C15H21F2N3O2 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | N-[4-(difluoromethyl)phenyl]-4-(2-hydroxyethyl)-3-methylpiperazine-1-carboxamide |
| SMILES | CC1CN(C(=O)Nc2ccc(C(F)F)cc2)CCN1CCO |
| InChI | InChI=1S/C15H21F2N3O2/c1-11-10-20(7-6-19(11)8-9-21)15(22)18-13-4-2-12(3-5-13)14(16)17/h2-5,11,14,21H,6-10H2,1H3,(H,18,22) |
| InChIKey | YHDOEVKTAUSALH-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |