C17H20N4O2 — CID 136564551
1-(2-cyclobutylpyrazol-3-yl)-3-(3,4-dihydro-1H-isochromen-4-yl)urea (PubChem CID 136564551) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 1-(2-cyclobutylpyrazol-3-yl)-3-(3,4-dihydro-1H-isochromen-4-yl)urea.
| Compound Name | 1-(2-cyclobutylpyrazol-3-yl)-3-(3,4-dihydro-1H-isochromen-4-yl)urea |
|---|---|
| PubChem CID | 136564551 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 1-(2-cyclobutylpyrazol-3-yl)-3-(3,4-dihydro-1H-isochromen-4-yl)urea |
| SMILES | O=C(Nc1ccnn1C1CCC1)NC1COCc2ccccc21 |
| InChI | InChI=1S/C17H20N4O2/c22-17(20-16-8-9-18-21(16)13-5-3-6-13)19-15-11-23-10-12-4-1-2-7-14(12)15/h1-2,4,7-9,13,15H,3,5-6,10-11H2,(H2,19,20,22) |
| InChIKey | LXGGGQMRPBWQQZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |