C14H17F2N5O — CID 136564938
1-(2,2-difluoroethyl)-3-methyl-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl)pyrazole-4-carboxamide (PubChem CID 136564938) has the molecular formula C14H17F2N5O and a molecular weight of 309.32 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-3-methyl-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl)pyrazole-4-carboxamide.
| Compound Name | 1-(2,2-difluoroethyl)-3-methyl-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 136564938 |
| Molecular Formula | C14H17F2N5O |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 1-(2,2-difluoroethyl)-3-methyl-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl)pyrazole-4-carboxamide |
| SMILES | Cc1nn(CC(F)F)cc1C(=O)NC1CCn2ccnc2C1 |
| InChI | InChI=1S/C14H17F2N5O/c1-9-11(7-21(19-9)8-12(15)16)14(22)18-10-2-4-20-5-3-17-13(20)6-10/h3,5,7,10,12H,2,4,6,8H2,1H3,(H,18,22) |
| InChIKey | GXLNKQHLKPIKKL-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |