C12H14F2N4O2 — CID 136568946
1-[3-[[6-(difluoromethyl)pyrimidin-4-yl]amino]propyl]pyrrolidine-2,5-dione (PubChem CID 136568946) has the molecular formula C12H14F2N4O2 and a molecular weight of 284.27 g/mol. Its IUPAC name is 1-[3-[[6-(difluoromethyl)pyrimidin-4-yl]amino]propyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[3-[[6-(difluoromethyl)pyrimidin-4-yl]amino]propyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 136568946 |
| Molecular Formula | C12H14F2N4O2 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 1-[3-[[6-(difluoromethyl)pyrimidin-4-yl]amino]propyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1CCCNc1cc(C(F)F)ncn1 |
| InChI | InChI=1S/C12H14F2N4O2/c13-12(14)8-6-9(17-7-16-8)15-4-1-5-18-10(19)2-3-11(18)20/h6-7,12H,1-5H2,(H,15,16,17) |
| InChIKey | FXYHWJOJXHWXNO-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|