C16H17N7O — CID 136570526
N-(1-cyclopropyltetrazol-5-yl)-5-methyl-1-(4-methylphenyl)pyrazole-3-carboxamide (PubChem CID 136570526) has the molecular formula C16H17N7O and a molecular weight of 323.36 g/mol. Its IUPAC name is N-(1-cyclopropyltetrazol-5-yl)-5-methyl-1-(4-methylphenyl)pyrazole-3-carboxamide.
| Compound Name | N-(1-cyclopropyltetrazol-5-yl)-5-methyl-1-(4-methylphenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 136570526 |
| Molecular Formula | C16H17N7O |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | N-(1-cyclopropyltetrazol-5-yl)-5-methyl-1-(4-methylphenyl)pyrazole-3-carboxamide |
| SMILES | Cc1ccc(-n2nc(C(=O)Nc3nnnn3C3CC3)cc2C)cc1 |
| InChI | InChI=1S/C16H17N7O/c1-10-3-5-12(6-4-10)22-11(2)9-14(19-22)15(24)17-16-18-20-21-23(16)13-7-8-13/h3-6,9,13H,7-8H2,1-2H3,(H,17,18,21,24) |
| InChIKey | MZIBDLGSSKXDDP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |