C9H10ClN7O — CID 154786288
4-chloro-N-(1-cyclopropyltetrazol-5-yl)-1-methylpyrazole-3-carboxamide (PubChem CID 154786288) has the molecular formula C9H10ClN7O and a molecular weight of 267.68 g/mol. Its IUPAC name is 4-chloro-N-(1-cyclopropyltetrazol-5-yl)-1-methylpyrazole-3-carboxamide.
| Compound Name | 4-chloro-N-(1-cyclopropyltetrazol-5-yl)-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 154786288 |
| Molecular Formula | C9H10ClN7O |
| Molecular Weight | 267.68 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 4-chloro-N-(1-cyclopropyltetrazol-5-yl)-1-methylpyrazole-3-carboxamide |
| SMILES | Cn1cc(Cl)c(C(=O)Nc2nnnn2C2CC2)n1 |
| InChI | InChI=1S/C9H10ClN7O/c1-16-4-6(10)7(13-16)8(18)11-9-12-14-15-17(9)5-2-3-5/h4-5H,2-3H2,1H3,(H,11,12,15,18) |
| InChIKey | UTQGBLYXBNZJIQ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.68 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |