C16H19N3O5 — CID 136570895
methyl 5-[[2-[(4-methoxyphenyl)methoxy]acetyl]amino]-1-methylpyrazole-3-carboxylate (PubChem CID 136570895) has the molecular formula C16H19N3O5 and a molecular weight of 333.34 g/mol. Its IUPAC name is methyl 5-[[2-[(4-methoxyphenyl)methoxy]acetyl]amino]-1-methylpyrazole-3-carboxylate.
| Compound Name | methyl 5-[[2-[(4-methoxyphenyl)methoxy]acetyl]amino]-1-methylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 136570895 |
| Molecular Formula | C16H19N3O5 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | methyl 5-[[2-[(4-methoxyphenyl)methoxy]acetyl]amino]-1-methylpyrazole-3-carboxylate |
| SMILES | COC(=O)c1cc(NC(=O)COCc2ccc(OC)cc2)n(C)n1 |
| InChI | InChI=1S/C16H19N3O5/c1-19-14(8-13(18-19)16(21)23-3)17-15(20)10-24-9-11-4-6-12(22-2)7-5-11/h4-8H,9-10H2,1-3H3,(H,17,20) |
| InChIKey | PFXHOZQEQOUORF-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |