C15H29N3O4 — CID 136571480
tert-butyl N-[1-[2-(methylcarbamoyl)morpholin-4-yl]butan-2-yl]carbamate (PubChem CID 136571480) has the molecular formula C15H29N3O4 and a molecular weight of 315.41 g/mol. Its IUPAC name is tert-butyl N-[1-[2-(methylcarbamoyl)morpholin-4-yl]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-(methylcarbamoyl)morpholin-4-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 136571480 |
| Molecular Formula | C15H29N3O4 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | tert-butyl N-[1-[2-(methylcarbamoyl)morpholin-4-yl]butan-2-yl]carbamate |
| SMILES | CCC(CN1CCOC(C(=O)NC)C1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H29N3O4/c1-6-11(17-14(20)22-15(2,3)4)9-18-7-8-21-12(10-18)13(19)16-5/h11-12H,6-10H2,1-5H3,(H,16,19)(H,17,20) |
| InChIKey | MFYSFFQRZHRPGS-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |