C14H13N3O3 — CID 136572226
3-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]pyrrolidine-2,5-dione (PubChem CID 136572226) has the molecular formula C14H13N3O3 and a molecular weight of 271.28 g/mol. Its IUPAC name is 3-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]pyrrolidine-2,5-dione.
| Compound Name | 3-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 136572226 |
| Molecular Formula | C14H13N3O3 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 3-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]pyrrolidine-2,5-dione |
| SMILES | Cc1ccccc1-c1noc(CC2CC(=O)NC2=O)n1 |
| InChI | InChI=1S/C14H13N3O3/c1-8-4-2-3-5-10(8)13-16-12(20-17-13)7-9-6-11(18)15-14(9)19/h2-5,9H,6-7H2,1H3,(H,15,18,19) |
| InChIKey | SBSURIMBJMFOTB-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|