C12H14FN5O — CID 136573388
2-amino-4-fluoro-N-[2-(5-methyl-1H-1,2,4-triazol-3-yl)ethyl]benzamide (PubChem CID 136573388) has the molecular formula C12H14FN5O and a molecular weight of 263.28 g/mol. Its IUPAC name is 2-amino-4-fluoro-N-[2-(5-methyl-1H-1,2,4-triazol-3-yl)ethyl]benzamide.
| Compound Name | 2-amino-4-fluoro-N-[2-(5-methyl-1H-1,2,4-triazol-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 136573388 |
| Molecular Formula | C12H14FN5O |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 2-amino-4-fluoro-N-[2-(5-methyl-1H-1,2,4-triazol-3-yl)ethyl]benzamide |
| SMILES | Cc1nc(CCNC(=O)c2ccc(F)cc2N)n[nH]1 |
| InChI | InChI=1S/C12H14FN5O/c1-7-16-11(18-17-7)4-5-15-12(19)9-3-2-8(13)6-10(9)14/h2-3,6H,4-5,14H2,1H3,(H,15,19)(H,16,17,18) |
| InChIKey | XKAZRGBFQDIHSB-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|