C11H18ClN3O4S — CID 136574876
5-chloro-6-(3-hydroxypropylamino)-N-(2-methoxyethyl)pyridine-3-sulfonamide (PubChem CID 136574876) has the molecular formula C11H18ClN3O4S and a molecular weight of 323.80 g/mol. Its IUPAC name is 5-chloro-6-(3-hydroxypropylamino)-N-(2-methoxyethyl)pyridine-3-sulfonamide.
| Compound Name | 5-chloro-6-(3-hydroxypropylamino)-N-(2-methoxyethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 136574876 |
| Molecular Formula | C11H18ClN3O4S |
| Molecular Weight | 323.80 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 5-chloro-6-(3-hydroxypropylamino)-N-(2-methoxyethyl)pyridine-3-sulfonamide |
| SMILES | COCCNS(=O)(=O)c1cnc(NCCCO)c(Cl)c1 |
| InChI | InChI=1S/C11H18ClN3O4S/c1-19-6-4-15-20(17,18)9-7-10(12)11(14-8-9)13-3-2-5-16/h7-8,15-16H,2-6H2,1H3,(H,13,14) |
| InChIKey | CYLMEFSDWUIKMN-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.80 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|