C8H9ClF3N3O2S — CID 75387454
2-amino-5-chloro-N-(3,3,3-trifluoropropyl)pyridine-3-sulfonamide (PubChem CID 75387454) has the molecular formula C8H9ClF3N3O2S and a molecular weight of 303.69 g/mol. Its IUPAC name is 2-amino-5-chloro-N-(3,3,3-trifluoropropyl)pyridine-3-sulfonamide.
| Compound Name | 2-amino-5-chloro-N-(3,3,3-trifluoropropyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 75387454 |
| Molecular Formula | C8H9ClF3N3O2S |
| Molecular Weight | 303.69 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | 2-amino-5-chloro-N-(3,3,3-trifluoropropyl)pyridine-3-sulfonamide |
| SMILES | Nc1ncc(Cl)cc1S(=O)(=O)NCCC(F)(F)F |
| InChI | InChI=1S/C8H9ClF3N3O2S/c9-5-3-6(7(13)14-4-5)18(16,17)15-2-1-8(10,11)12/h3-4,15H,1-2H2,(H2,13,14) |
| InChIKey | FKDOCQPHLVABKK-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.69 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |