C14H18N4O2S — CID 136575719
N-[[(2-aminobenzoyl)amino]carbamothioyl]cyclopentanecarboxamide (PubChem CID 136575719) has the molecular formula C14H18N4O2S and a molecular weight of 306.39 g/mol. Its IUPAC name is N-[[(2-aminobenzoyl)amino]carbamothioyl]cyclopentanecarboxamide.
| Compound Name | N-[[(2-aminobenzoyl)amino]carbamothioyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 136575719 |
| Molecular Formula | C14H18N4O2S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | N-[[(2-aminobenzoyl)amino]carbamothioyl]cyclopentanecarboxamide |
| SMILES | Nc1ccccc1C(=O)NNC(=S)NC(=O)C1CCCC1 |
| InChI | InChI=1S/C14H18N4O2S/c15-11-8-4-3-7-10(11)13(20)17-18-14(21)16-12(19)9-5-1-2-6-9/h3-4,7-9H,1-2,5-6,15H2,(H,17,20)(H2,16,18,19,21) |
| InChIKey | ISJQFWAPMAYBOY-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|