C18H26N2O3 — CID 136576671
N-[(E)-(2-hydroxy-4-oxospiro[5.5]undec-2-en-3-yl)methylideneamino]cyclopentanecarboxamide (PubChem CID 136576671) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is N-[(E)-(2-hydroxy-4-oxospiro[5.5]undec-2-en-3-yl)methylideneamino]cyclopentanecarboxamide.
| Compound Name | N-[(E)-(2-hydroxy-4-oxospiro[5.5]undec-2-en-3-yl)methylideneamino]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 136576671 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | N-[(E)-(2-hydroxy-4-oxospiro[5.5]undec-2-en-3-yl)methylideneamino]cyclopentanecarboxamide |
| SMILES | O=C1CC2(CCCCC2)CC(O)=C1/C=N/NC(=O)C1CCCC1 |
| InChI | InChI=1S/C18H26N2O3/c21-15-10-18(8-4-1-5-9-18)11-16(22)14(15)12-19-20-17(23)13-6-2-3-7-13/h12-13,21H,1-11H2,(H,20,23)/b19-12+ |
| InChIKey | XGJWVKZCBOUDHI-XDHOZWIPSA-N |
| XLogP | 3.40 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_enamin(30)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|