C14H27NO3S — CID 136578705
N-(4-tert-butylcyclohexyl)-N-methyl-2-methylsulfonylacetamide (PubChem CID 136578705) has the molecular formula C14H27NO3S and a molecular weight of 289.44 g/mol. Its IUPAC name is N-(4-tert-butylcyclohexyl)-N-methyl-2-methylsulfonylacetamide.
| Compound Name | N-(4-tert-butylcyclohexyl)-N-methyl-2-methylsulfonylacetamide |
|---|---|
| PubChem CID | 136578705 |
| Molecular Formula | C14H27NO3S |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | N-(4-tert-butylcyclohexyl)-N-methyl-2-methylsulfonylacetamide |
| SMILES | CN(C(=O)CS(C)(=O)=O)C1CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C14H27NO3S/c1-14(2,3)11-6-8-12(9-7-11)15(4)13(16)10-19(5,17)18/h11-12H,6-10H2,1-5H3 |
| InChIKey | JOWYJURUABYRKO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |