C19H23N3OS — CID 136579366
3-cyclopropyl-N-[1-(pyridin-4-ylmethyl)piperidin-4-yl]thiophene-2-carboxamide (PubChem CID 136579366) has the molecular formula C19H23N3OS and a molecular weight of 341.48 g/mol. Its IUPAC name is 3-cyclopropyl-N-[1-(pyridin-4-ylmethyl)piperidin-4-yl]thiophene-2-carboxamide.
| Compound Name | 3-cyclopropyl-N-[1-(pyridin-4-ylmethyl)piperidin-4-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 136579366 |
| Molecular Formula | C19H23N3OS |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 3-cyclopropyl-N-[1-(pyridin-4-ylmethyl)piperidin-4-yl]thiophene-2-carboxamide |
| SMILES | O=C(NC1CCN(Cc2ccncc2)CC1)c1sccc1C1CC1 |
| InChI | InChI=1S/C19H23N3OS/c23-19(18-17(7-12-24-18)15-1-2-15)21-16-5-10-22(11-6-16)13-14-3-8-20-9-4-14/h3-4,7-9,12,15-16H,1-2,5-6,10-11,13H2,(H,21,23) |
| InChIKey | SPILJOKYPABUNY-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |