C17H19Cl2N3O3 — CID 136579470
1-[1-(3,4-dichlorobenzoyl)pyrrolidine-2-carbonyl]-1,4-diazepan-5-one (PubChem CID 136579470) has the molecular formula C17H19Cl2N3O3 and a molecular weight of 384.26 g/mol. Its IUPAC name is 1-[1-(3,4-dichlorobenzoyl)pyrrolidine-2-carbonyl]-1,4-diazepan-5-one.
| Compound Name | 1-[1-(3,4-dichlorobenzoyl)pyrrolidine-2-carbonyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 136579470 |
| Molecular Formula | C17H19Cl2N3O3 |
| Molecular Weight | 384.26 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 1-[1-(3,4-dichlorobenzoyl)pyrrolidine-2-carbonyl]-1,4-diazepan-5-one |
| SMILES | O=C1CCN(C(=O)C2CCCN2C(=O)c2ccc(Cl)c(Cl)c2)CCN1 |
| InChI | InChI=1S/C17H19Cl2N3O3/c18-12-4-3-11(10-13(12)19)16(24)22-7-1-2-14(22)17(25)21-8-5-15(23)20-6-9-21/h3-4,10,14H,1-2,5-9H2,(H,20,23) |
| InChIKey | MNVGDINOOWDMLC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |