C15H20F2N4O2 — CID 136582536
(3aR,6aR)-N-[2-(2,2-difluoroethoxy)-3-pyridinyl]-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxamide (PubChem CID 136582536) has the molecular formula C15H20F2N4O2 and a molecular weight of 326.35 g/mol. Its IUPAC name is (3aR,6aR)-N-[2-(2,2-difluoroethoxy)-3-pyridinyl]-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxamide.
| Compound Name | (3aR,6aR)-N-[2-(2,2-difluoroethoxy)-3-pyridinyl]-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 136582536 |
| Molecular Formula | C15H20F2N4O2 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | (3aR,6aR)-N-[2-(2,2-difluoroethoxy)-3-pyridinyl]-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxamide |
| SMILES | CN1CC[C@@H]2CN(C(=O)Nc3cccnc3OCC(F)F)C[C@@H]21 |
| InChI | InChI=1S/C15H20F2N4O2/c1-20-6-4-10-7-21(8-12(10)20)15(22)19-11-3-2-5-18-14(11)23-9-13(16)17/h2-3,5,10,12-13H,4,6-9H2,1H3,(H,19,22)/t10-,12+/m1/s1 |
| InChIKey | BYUHWVXTLHPNDA-PWSUYJOCSA-N |
| XLogP | 1.89 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |