C18H22FN5O — CID 128618290
(3aR,6aR)-N-[1-(2-fluorophenyl)-5-methylpyrazol-4-yl]-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxamide (PubChem CID 128618290) has the molecular formula C18H22FN5O and a molecular weight of 343.41 g/mol. Its IUPAC name is (3aR,6aR)-N-[1-(2-fluorophenyl)-5-methylpyrazol-4-yl]-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxamide.
| Compound Name | (3aR,6aR)-N-[1-(2-fluorophenyl)-5-methylpyrazol-4-yl]-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 128618290 |
| Molecular Formula | C18H22FN5O |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | (3aR,6aR)-N-[1-(2-fluorophenyl)-5-methylpyrazol-4-yl]-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxamide |
| SMILES | Cc1c(NC(=O)N2C[C@H]3CCN(C)[C@H]3C2)cnn1-c1ccccc1F |
| InChI | InChI=1S/C18H22FN5O/c1-12-15(9-20-24(12)16-6-4-3-5-14(16)19)21-18(25)23-10-13-7-8-22(2)17(13)11-23/h3-6,9,13,17H,7-8,10-11H2,1-2H3,(H,21,25)/t13-,17+/m1/s1 |
| InChIKey | QHTBCTGTZFOLAP-DYVFJYSZSA-N |
| XLogP | 2.49 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |