C15H18FNO3S — CID 136582894
N-[[(1S,4R)-2-bicyclo[2.2.1]heptanyl]sulfonyl]-3-fluoro-2-methylbenzamide (PubChem CID 136582894) has the molecular formula C15H18FNO3S and a molecular weight of 311.38 g/mol. Its IUPAC name is N-[[(1S,4R)-2-bicyclo[2.2.1]heptanyl]sulfonyl]-3-fluoro-2-methylbenzamide.
| Compound Name | N-[[(1S,4R)-2-bicyclo[2.2.1]heptanyl]sulfonyl]-3-fluoro-2-methylbenzamide |
|---|---|
| PubChem CID | 136582894 |
| Molecular Formula | C15H18FNO3S |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | N-[[(1S,4R)-2-bicyclo[2.2.1]heptanyl]sulfonyl]-3-fluoro-2-methylbenzamide |
| SMILES | Cc1c(F)cccc1C(=O)NS(=O)(=O)C1C[C@@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C15H18FNO3S/c1-9-12(3-2-4-13(9)16)15(18)17-21(19,20)14-8-10-5-6-11(14)7-10/h2-4,10-11,14H,5-8H2,1H3,(H,17,18)/t10-,11+,14?/m1/s1 |
| InChIKey | IFGVRPXHWHRUEJ-ZAZPPBBNSA-N |
| XLogP | 2.38 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |