C15H17ClN4O2 — CID 136583251
2-chloro-3-[[(2S)-2-(triazol-1-ylmethyl)pyrrolidin-1-yl]methyl]benzoic acid (PubChem CID 136583251) has the molecular formula C15H17ClN4O2 and a molecular weight of 320.78 g/mol. Its IUPAC name is 2-chloro-3-[[(2S)-2-(triazol-1-ylmethyl)pyrrolidin-1-yl]methyl]benzoic acid.
| Compound Name | 2-chloro-3-[[(2S)-2-(triazol-1-ylmethyl)pyrrolidin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 136583251 |
| Molecular Formula | C15H17ClN4O2 |
| Molecular Weight | 320.78 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 2-chloro-3-[[(2S)-2-(triazol-1-ylmethyl)pyrrolidin-1-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CN2CCC[C@H]2Cn2ccnn2)c1Cl |
| InChI | InChI=1S/C15H17ClN4O2/c16-14-11(3-1-5-13(14)15(21)22)9-19-7-2-4-12(19)10-20-8-6-17-18-20/h1,3,5-6,8,12H,2,4,7,9-10H2,(H,21,22)/t12-/m0/s1 |
| InChIKey | MVCMHKNHKMDZKV-LBPRGKRZSA-N |
| XLogP | 2.29 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.78 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |