C13H14ClN5O — CID 120949586
(5-chloro-2-pyridinyl)-[(2S)-2-(triazol-1-ylmethyl)pyrrolidin-1-yl]methanone (PubChem CID 120949586) has the molecular formula C13H14ClN5O and a molecular weight of 291.74 g/mol. Its IUPAC name is (5-chloro-2-pyridinyl)-[(2S)-2-(triazol-1-ylmethyl)pyrrolidin-1-yl]methanone.
| Compound Name | (5-chloro-2-pyridinyl)-[(2S)-2-(triazol-1-ylmethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 120949586 |
| Molecular Formula | C13H14ClN5O |
| Molecular Weight | 291.74 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | (5-chloro-2-pyridinyl)-[(2S)-2-(triazol-1-ylmethyl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1ccc(Cl)cn1)N1CCC[C@H]1Cn1ccnn1 |
| InChI | InChI=1S/C13H14ClN5O/c14-10-3-4-12(15-8-10)13(20)19-6-1-2-11(19)9-18-7-5-16-17-18/h3-5,7-8,11H,1-2,6,9H2/t11-/m0/s1 |
| InChIKey | BRVFFYTZFOAOKV-NSHDSACASA-N |
| XLogP | 1.63 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.74 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |